1-amino-4-anilino-2-methoxy-anthracene-9,10-dione structure
|
Common Name | 1-amino-4-anilino-2-methoxy-anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 90791-37-0 | Molecular Weight | 344.36300 | |
| Density | 1.369g/cm3 | Boiling Point | 591.6ºC at 760 mmHg | |
| Molecular Formula | C21H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6ºC | |
| Name | 1-amino-4-anilino-2-methoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 591.6ºC at 760 mmHg |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.36300 |
| Flash Point | 311.6ºC |
| Exact Mass | 344.11600 |
| PSA | 81.42000 |
| LogP | 4.45060 |
| Index of Refraction | 1.716 |
| InChIKey | XUWMGNPWAPODQF-UHFFFAOYSA-N |
| SMILES | COc1cc(Nc2ccccc2)c2c(c1N)C(=O)c1ccccc1C2=O |
|
~%
1-amino-4-anili... CAS#:90791-37-0 |
| Literature: Ukponmwan; Greenhalgh; Peters Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 482 - 483 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-amino-4-anilino-2-methoxy-anthracene-9,10-dione |
| 1-amino-2-methoxy-4-anilinoanthraquinone |