Formic acid, chloro-, ester with 4a(2)-hydroxypropiophenone structure
|
Common Name | Formic acid, chloro-, ester with 4a(2)-hydroxypropiophenone | ||
|---|---|---|---|---|
| CAS Number | 90798-08-6 | Molecular Weight | 212.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Formic acid, chloro-, ester with 4a(2)-hydroxypropiophenone |
|---|
| Molecular Formula | C10H9ClO3 |
|---|---|
| Molecular Weight | 212.63 |
| InChIKey | QAAXSMZKKDVZGE-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(OC(=O)Cl)cc1 |