1-Chloro-5-fluoro-4-nitro-2-(trichloromethyl)benzene structure
|
Common Name | 1-Chloro-5-fluoro-4-nitro-2-(trichloromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 908009-54-1 | Molecular Weight | 292.907 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 333.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H2Cl4FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3±26.5 °C | |
| Name | 1-Chloro-5-fluoro-4-nitro-2-(trichloromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 333.1±37.0 °C at 760 mmHg |
| Molecular Formula | C7H2Cl4FNO2 |
| Molecular Weight | 292.907 |
| Flash Point | 155.3±26.5 °C |
| Exact Mass | 290.882355 |
| PSA | 45.82000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | MVUXTPPFKISHQY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(Cl)(Cl)Cl)c(Cl)cc1F |
| HS Code | 2904909090 |
|---|
|
~93%
1-Chloro-5-fluo... CAS#:908009-54-1 |
| Literature: MITENI S.p.A. Patent: EP1853548 B1, 2009 ; Location in patent: Page/Page column 5-6 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-4-fluoro-5-nitrobenzotrichloride |
| Benzene, 1-chloro-5-fluoro-4-nitro-2-(trichloromethyl)- |
| 1-Chloro-5-fluoro-4-nitro-2-(trichloromethyl)benzene |