5,6,7-TRIMETHYL-2,6-DIHYDRO-1H-PYRROLO[3,4-D]PYRIDAZIN-1-ONE structure
|
Common Name | 5,6,7-TRIMETHYL-2,6-DIHYDRO-1H-PYRROLO[3,4-D]PYRIDAZIN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 90817-87-1 | Molecular Weight | 177.20300 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6,7-trimethyl-2H-pyrrolo[3,4-d]pyridazin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.20300 |
| Exact Mass | 177.09000 |
| PSA | 50.68000 |
| LogP | 0.87840 |
| Index of Refraction | 1.649 |
| InChIKey | YHMCEAGPNVSJHN-UHFFFAOYSA-N |
| SMILES | Cc1c2cn[nH]c(=O)c2c(C)n1C |
| HS Code | 2933990090 |
|---|
|
~84%
5,6,7-TRIMETHYL... CAS#:90817-87-1 |
| Literature: Inel, Sermin; Jones, R. Alan; Ogretir, Cemil Tetrahedron, 1984 , vol. 40, # 20 p. 3979 - 3986 |
|
~%
5,6,7-TRIMETHYL... CAS#:90817-87-1 |
| Literature: Inel, Sermin; Jones, R. Alan; Ogretir, Cemil Tetrahedron, 1984 , vol. 40, # 20 p. 3979 - 3986 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-dihydro-5,6,7-trimethyl-6H-pyrrolo<3,4-d>pyridazine-1-one |
| 5,6,7-trimethyl-2,6-dihydro-1H-pyrrolo[3,4-d]pyridazin-1-one |