trimethyl(2-pentanoyloxyethyl)azanium,chloride structure
|
Common Name | trimethyl(2-pentanoyloxyethyl)azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 90830-40-3 | Molecular Weight | 223.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(2-pentanoyloxyethyl)azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H22ClNO2 |
|---|---|
| Molecular Weight | 223.74000 |
| Exact Mass | 223.13400 |
| PSA | 26.30000 |
| InChIKey | JTLHYCGXOYLZMM-UHFFFAOYSA-M |
| SMILES | CCCCC(=O)OCC[N+](C)(C)C.[Cl-] |
|
~%
trimethyl(2-pen... CAS#:90830-40-3 |
| Literature: Dudley Journal of the Chemical Society, 1931 , p. 765,767 |
| Ethanaminium,N,N,N-trimethyl-2-[(1-oxopentyl)oxy]-,chloride |
| trimethyl-(2-valeryloxy-ethyl)-ammonium,chloride |
| Trimethyl-(2-valeryloxy-aethyl)-ammonium,Chlorid |