3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide structure
|
Common Name | 3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 908494-47-3 | Molecular Weight | 223.69900 | |
| Density | 1.246g/cm3 | Boiling Point | 408.413ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.801ºC | |
| Name | 3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 408.413ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.69900 |
| Flash Point | 200.801ºC |
| Exact Mass | 223.07600 |
| PSA | 29.10000 |
| LogP | 2.81570 |
| Index of Refraction | 1.609 |
| InChIKey | QJMWYGURKXRWFW-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)Nc1ccc2c(c1)CCC2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chloro-N-indan-5-ylpropanamide |
| 3-chloro-N-2,3-dihydro-1H-inden-5-ylpropanamide |