4-propan-2-yl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 4-propan-2-yl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 90871-42-4 | Molecular Weight | 220.29400 | |
| Density | 1.3g/cm3 | Boiling Point | 405.7ºC at 760 mmHg | |
| Molecular Formula | C10H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | 4-propan-2-yl-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 405.7ºC at 760 mmHg |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.29400 |
| Flash Point | 199.1ºC |
| Exact Mass | 220.07800 |
| PSA | 82.40000 |
| LogP | 2.20970 |
| Index of Refraction | 1.679 |
| InChIKey | LHGOGSSATFKPDL-UHFFFAOYSA-N |
| SMILES | CC(C)n1c(-c2cccnc2)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-isopropyl-5-pyridin-3-yl-4h-1,2,4-triazole-3-thiol |