4H-1,3-Oxazine,5,6-dihydro-2-(2-nitrophenyl)- structure
|
Common Name | 4H-1,3-Oxazine,5,6-dihydro-2-(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 90915-72-3 | Molecular Weight | 206.19800 | |
| Density | 1.34g/cm3 | Boiling Point | 363.5ºC at 760mmHg | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 2-(2-nitrophenyl)-5,6-dihydro-4H-1,3-oxazine |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760mmHg |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Flash Point | 173.7ºC |
| Exact Mass | 206.06900 |
| PSA | 67.41000 |
| LogP | 1.72050 |
| Index of Refraction | 1.617 |
| InChIKey | SVLMVEXFFAVEMR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1C1=NCCCO1 |
|
~%
4H-1,3-Oxazine,... CAS#:90915-72-3 |
| Literature: Novelli; Adams Journal of the American Chemical Society, 1937 , vol. 59, p. 2259 |
|
~%
4H-1,3-Oxazine,... CAS#:90915-72-3 |
| Literature: Novelli; Adams Journal of the American Chemical Society, 1937 , vol. 59, p. 2259 |
|
~%
4H-1,3-Oxazine,... CAS#:90915-72-3 |
| Literature: Eckstein,Z. et al. Roczniki Chemii, 1962 , vol. 36, p. 73 - 85 |