4'',5''-dimethyl-2''-hydroxy-3''-nitroacetophenone structure
|
Common Name | 4'',5''-dimethyl-2''-hydroxy-3''-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 90922-67-1 | Molecular Weight | 209.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4'',5''-dimethyl-2''-hydroxy-3''-nitroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO4 |
|---|---|
| Molecular Weight | 209.19900 |
| Exact Mass | 209.06900 |
| PSA | 83.12000 |
| LogP | 2.64300 |
| InChIKey | CNMHPLQSONTTSK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C)c(C)c([N+](=O)[O-])c1O |
|
~%
4'',5''-dimethy... CAS#:90922-67-1 |
| Literature: Baker et al. Journal of the Chemical Society, 1953 , p. 820 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Hydroxy-4,5-dimethyl-3-nitro-acetophenon |
| 4',5'-Dimethoxy-2'-hydroxyacetophenone |
| 1-acetyl-2-hydroxy-4,5-dimethoxybenzene |
| 2'-Hydroxy-4',5'-dimethoxyacetophenone |
| 2-Hydroxy-3-nitro-4,5-dimethyl-acetophenon |
| 2'-hydroxy-4',5'-dimethyleneoxyacetophenone |