[(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride structure
|
Common Name | [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 90944-00-6 | Molecular Weight | 254.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14Cl3N |
|---|---|
| Molecular Weight | 254.6 |
| InChIKey | YOJLUQBTFIYLOV-UHFFFAOYSA-N |
| SMILES | CC(C)NCc1ccc(Cl)c(Cl)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: CAS number of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is 90944-00-6. |
| Q: What is the SMILES notation of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: SMILES notation of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is CC(C)NCc1ccc(Cl)c(Cl)c1.Cl. |
| Q: What is the molecular formula of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: Molecular formula of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is C10H14Cl3N. |
| Q: What is the InChIKey of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: InChIKey of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is YOJLUQBTFIYLOV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: Molecular weight of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is 254.6. |
| Q: What is the Chinese name of 90944-00-6? |
| A: Chinese name of 90944-00-6 is 90944-00-6. |
| Q: What is the English name of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride? |
| A: The English name of [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride is [(3,4-Dichlorophenyl)methyl](propan-2-yl)amine hydrochloride. |