4-METHYL-1-(4-NITROPHENYL)-1H-IMIDAZOLE structure
|
Common Name | 4-METHYL-1-(4-NITROPHENYL)-1H-IMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 90946-21-7 | Molecular Weight | 203.19700 | |
| Density | 1.29g/cm3 | Boiling Point | 385.9ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 4-methyl-1-(4-nitrophenyl)imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 385.9ºC at 760 mmHg |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.19700 |
| Flash Point | 187.2ºC |
| Exact Mass | 203.06900 |
| PSA | 63.64000 |
| LogP | 2.61210 |
| Index of Refraction | 1.634 |
| InChIKey | BBTVYTDNOUZWNJ-UHFFFAOYSA-N |
| SMILES | Cc1cn(-c2ccc([N+](=O)[O-])cc2)cn1 |
| HS Code | 2933290090 |
|---|
|
~%
4-METHYL-1-(4-N... CAS#:90946-21-7 |
| Literature: TARGEGEN, INC. Patent: WO2007/53452 A1, 2007 ; Location in patent: Page/Page column 188 ; WO 2007/053452 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Imidazole,4-methyl-1-(4-nitrophenyl) |
| 4-METHYL-1-(4-NITROPHENYL)-1H-IMIDAZOLE |
| 4-Methyl-1-<4-nitro-phenyl>-imidazol |
| N-(4-nitrophenyl)-4-methylimidazole |
| 4-(4-methyl-1H-imidazol-1-yl)nitrobenzene |