3-tert-butyl-7-chloroisochromen-1-one structure
|
Common Name | 3-tert-butyl-7-chloroisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 90991-99-4 | Molecular Weight | 236.69400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-7-chloroisochromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13ClO2 |
|---|---|
| Molecular Weight | 236.69400 |
| Exact Mass | 236.06000 |
| PSA | 30.21000 |
| LogP | 3.74390 |
| InChIKey | VLMJAJBFBDAKHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2ccc(Cl)cc2c(=O)o1 |
|
~66%
3-tert-butyl-7-... CAS#:90991-99-4 |
| Literature: Larock, R. C.; Varaprath, S.; Lau, H. H.; Fellows, C. A. Journal of the American Chemical Society, 1984 , vol. 106, # 18 p. 5274 - 5284 |
| 1H-2-Benzopyran-1-one,7-chloro-3-(1,1-dimethylethyl) |
| 3-tert-butyl-7-chloroisocoumarin |