6-(1,3-benzodioxol-5-yl)pyran-2-one
6-(1,3-benzodioxol-5-yl)pyran-2-one structure
|
Common Name | 6-(1,3-benzodioxol-5-yl)pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 91-89-4 | Molecular Weight | 216.19000 | |
| Density | 1.404g/cm3 | Boiling Point | 428.5ºC at 760 mmHg | |
| Molecular Formula | C12H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(1,3-benzodioxol-5-yl)pyran-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.404g/cm3 |
|---|---|
| Boiling Point | 428.5ºC at 760 mmHg |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19000 |
| Flash Point | 196.2ºC |
| Exact Mass | 216.04200 |
| PSA | 48.67000 |
| LogP | 2.03550 |
| Index of Refraction | 1.627 |
| InChIKey | FTGVBKACGWMZPN-UHFFFAOYSA-N |
| SMILES | O=c1cccc(-c2ccc3c(c2)OCO3)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-(3,4-(Methylenedioxy)phenyl)-2H-pyran-2-one |
| 6-Benzo[1,3]dioxol-5-yl-pyran-2-on |
| Paracotoin |
| 2H-Pyran-2-one,6-(3,4-(methylenedioxy)phenyl) |
| 6-<3,4-Methylendioxy-phenyl>-pyron-(2) |
| 6-(1,3-benzodioxol-5-yl)-2h-pyran-2-one |
| 6-(benzo[1,3]dioxol-5-yl)pyran-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: InChIKey of 6-(1,3-benzodioxol-5-yl)pyran-2-one is FTGVBKACGWMZPN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: Molecular weight of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 216.19000. |
| Q: What is the LogP of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: LogP of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 2.03550. |
| Q: What is the SMILES notation of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: SMILES notation of 6-(1,3-benzodioxol-5-yl)pyran-2-one is O=c1cccc(-c2ccc3c(c2)OCO3)o1. |
| Q: What English synonyms does 6-(1,3-benzodioxol-5-yl)pyran-2-one have? |
| A: English synonyms of 6-(1,3-benzodioxol-5-yl)pyran-2-one: 6-(3,4-(Methylenedioxy)phenyl)-2H-pyran-2-one, 6-Benzo[1,3]dioxol-5-yl-pyran-2-on, Paracotoin, 2H-Pyran-2-one,6-(3,4-(methylenedioxy)phenyl), 6--pyron-(2), 6-(1,3-benzodioxol-5-yl)-2h-pyran-2-one, 6-(benzo[1,3]dioxol-5-yl)pyran-2-one. |
| Q: What is the molecular formula of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: Molecular formula of 6-(1,3-benzodioxol-5-yl)pyran-2-one is C12H8O4. |
| Q: What is the boiling point of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: Boiling point of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 428.5ºC at 760 mmHg. |
| Q: What is the English name of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: The English name of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 6-(1,3-benzodioxol-5-yl)pyran-2-one. |
| Q: What is the CAS number of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: CAS number of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 91-89-4. |
| Q: What is the polar surface area (PSA) of 6-(1,3-benzodioxol-5-yl)pyran-2-one? |
| A: Polar surface area (PSA) of 6-(1,3-benzodioxol-5-yl)pyran-2-one is 48.67000. |