5(4H)-Oxazolone,4-[(4,5-diethoxy-2-nitrophenyl)methylene]-2-phenyl
![5(4H)-Oxazolone,4-[(4,5-diethoxy-2-nitrophenyl)methylene]-2-phenyl Structure](https://image.chemsrc.com/caspic/134/910-71-4.png)
5(4H)-Oxazolone,4-[(4,5-diethoxy-2-nitrophenyl)methylene]-2-phenyl structure
|
Common Name | 5(4H)-Oxazolone,4-[(4,5-diethoxy-2-nitrophenyl)methylene]-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 910-71-4 | Molecular Weight | 382.36700 | |
| Density | 1.3g/cm3 | Boiling Point | 565.4ºC at 760mmHg | |
| Molecular Formula | C20H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 565.4ºC at 760mmHg |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.36700 |
| Flash Point | 295.8ºC |
| Exact Mass | 382.11600 |
| PSA | 102.94000 |
| LogP | 3.69550 |
| Index of Refraction | 1.599 |
| InChIKey | FXAWKJINURXXPC-XNTDXEJSSA-N |
| SMILES | CCOc1cc(C=C2N=C(c3ccccc3)OC2=O)c([N+](=O)[O-])cc1OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5(4H)-Oxazolone... CAS#:910-71-4 |
| Literature: Walter,R.; Zimmer,H. Journal fuer Praktische Chemie (Leipzig), 1964 , vol. 26, p. 127 - 129 |
|
~%
5(4H)-Oxazolone... CAS#:910-71-4 |
| Literature: Walter,R.; Zimmer,H. Journal fuer Praktische Chemie (Leipzig), 1964 , vol. 26, p. 127 - 129 |
![4-[(3,4-diethoxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one structure](https://image.chemsrc.com/caspic/314/88828-04-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-furfurylidene-2-phenyl-4H-oxazol-5-one |
| 2-Phenyl-4-furfuryliden-4,5-dihydro-oxazol-5-on |
| 2-Phenyl-4-furfuryliden-oxazol-5-on |
| 4-Furfuryliden-2-phenyl-4H-oxazol-5-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: Molecular weight of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is 382.36700. |
| Q: What are the upstream materials of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: Related upstream materials(CAS) of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one: 88828-04-0;495-69-2;55149-82-1. |
| Q: What is the boiling point of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: Boiling point of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is 565.4ºC at 760mmHg. |
| Q: What is the Chinese name of 910-71-4? |
| A: Chinese name of 910-71-4 is 910-71-4. |
| Q: What is the LogP of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: LogP of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is 3.69550. |
| Q: What is the molecular formula of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: Molecular formula of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is C20H18N2O6. |
| Q: What English synonyms does 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one have? |
| A: English synonyms of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one: 4-furfurylidene-2-phenyl-4H-oxazol-5-one, 2-Phenyl-4-furfuryliden-4,5-dihydro-oxazol-5-on, 2-Phenyl-4-furfuryliden-oxazol-5-on, 4-Furfuryliden-2-phenyl-4H-oxazol-5-on. |
| Q: What is the CAS number of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: CAS number of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is 910-71-4. |
| Q: What is the polar surface area (PSA) of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: Polar surface area (PSA) of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is 102.94000. |
| Q: What is the SMILES notation of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one? |
| A: SMILES notation of 4-[(4,5-diethoxy-2-nitrophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one is CCOc1cc(C=C2N=C(c3ccccc3)OC2=O)c([N+](=O)[O-])cc1OCC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |