2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzonitrile structure
|
Common Name | 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 910037-17-1 | Molecular Weight | 251.20700 | |
| Density | 1.29g/cm3 | Boiling Point | 372.8ºC at 760 mmHg | |
| Molecular Formula | C12H8F3N3 | Melting Point | 101-103ºC | |
| MSDS | N/A | Flash Point | 179.3ºC | |
| Name | 2-[2-methyl-5-(trifluoromethyl)pyrazol-3-yl]benzonitrile |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760 mmHg |
| Melting Point | 101-103ºC |
| Molecular Formula | C12H8F3N3 |
| Molecular Weight | 251.20700 |
| Flash Point | 179.3ºC |
| Exact Mass | 251.06700 |
| PSA | 41.61000 |
| LogP | 2.97758 |
| Index of Refraction | 1.547 |
| InChIKey | RHTYRUPBJDKBMM-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccccc1C#N |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |