2,3-DIISOPROPYLSUCCINIC ACID
2,3-DIISOPROPYLSUCCINIC ACID structure
|
Common Name | 2,3-DIISOPROPYLSUCCINIC ACID | ||
|---|---|---|---|---|
| CAS Number | 91007-67-9 | Molecular Weight | 202.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-di(propan-2-yl)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18O4 |
|---|---|
| Molecular Weight | 202.24800 |
| Exact Mass | 202.12100 |
| PSA | 74.60000 |
| LogP | 1.70000 |
| InChIKey | HSCLUIKEZDGKBP-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)C(C(=O)O)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Russian Chemical Bulletin, , vol. 58, # 8 p. 1672 - 1680 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Chemische Berichte, , vol. 22, p. 50 Journal of the Chemical Society, , vol. 77, p. 654 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 13, p. 40,44 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 17, # 5 p. 1196 - 1202 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 13, p. 40,44 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 13, p. 40,44 |
|
~%
2,3-DIISOPROPYL... CAS#:91007-67-9
2,3-DIISOPROPYL... CAS#:91007-67-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 13, p. 40,44 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| meso-2,3-diisopropyl-succinic acid |
| meso-2,3-Diisopropyl-bernsteinsaeure |
| 2,3-DIISOPROPYLSUCCINIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-di(propan-2-yl)butanedioic acid? |
| A: CAS number of 2,3-di(propan-2-yl)butanedioic acid is 91007-67-9. |
| Q: What is the molecular weight of 2,3-di(propan-2-yl)butanedioic acid? |
| A: Molecular weight of 2,3-di(propan-2-yl)butanedioic acid is 202.24800. |
| Q: What is the Chinese name of 91007-67-9? |
| A: Chinese name of 91007-67-9 is 91007-67-9. |
| Q: What is the LogP of 2,3-di(propan-2-yl)butanedioic acid? |
| A: LogP of 2,3-di(propan-2-yl)butanedioic acid is 1.70000. |
| Q: What is the SMILES notation of 2,3-di(propan-2-yl)butanedioic acid? |
| A: SMILES notation of 2,3-di(propan-2-yl)butanedioic acid is CC(C)C(C(=O)O)C(C(=O)O)C(C)C. |
| Q: What is the molecular formula of 2,3-di(propan-2-yl)butanedioic acid? |
| A: Molecular formula of 2,3-di(propan-2-yl)butanedioic acid is C10H18O4. |
| Q: What is the polar surface area (PSA) of 2,3-di(propan-2-yl)butanedioic acid? |
| A: Polar surface area (PSA) of 2,3-di(propan-2-yl)butanedioic acid is 74.60000. |
| Q: What is the English name of 2,3-di(propan-2-yl)butanedioic acid? |
| A: The English name of 2,3-di(propan-2-yl)butanedioic acid is 2,3-di(propan-2-yl)butanedioic acid. |
| Q: What English synonyms does 2,3-di(propan-2-yl)butanedioic acid have? |
| A: English synonyms of 2,3-di(propan-2-yl)butanedioic acid: meso-2,3-diisopropyl-succinic acid, meso-2,3-Diisopropyl-bernsteinsaeure, 2,3-DIISOPROPYLSUCCINIC ACID. |
| Q: What is the InChIKey of 2,3-di(propan-2-yl)butanedioic acid? |
| A: InChIKey of 2,3-di(propan-2-yl)butanedioic acid is HSCLUIKEZDGKBP-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |