5-Phenylisoindoline hydrochloride
Modify Date: 2026-09-22 11:21:31
5-Phenylisoindoline hydrochloride structure
|
Common Name | 5-Phenylisoindoline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 910237-77-3 | Molecular Weight | 231.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Phenylisoindoline hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14ClN |
|---|---|
| Molecular Weight | 231.72 |
| InChIKey | NTFGSIASEVKBBZ-UHFFFAOYSA-N |
| SMILES | Cl.c1ccc(-c2ccc3c(c2)CNC3)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 910237-77-3? |
| A: Chinese name of 910237-77-3 is 910237-77-3. |
| Q: What is the molecular formula of 5-Phenylisoindoline hydrochloride? |
| A: Molecular formula of 5-Phenylisoindoline hydrochloride is C14H14ClN. |
| Q: What is the InChIKey of 5-Phenylisoindoline hydrochloride? |
| A: InChIKey of 5-Phenylisoindoline hydrochloride is NTFGSIASEVKBBZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-Phenylisoindoline hydrochloride? |
| A: SMILES notation of 5-Phenylisoindoline hydrochloride is Cl.c1ccc(-c2ccc3c(c2)CNC3)cc1. |
| Q: What is the CAS number of 5-Phenylisoindoline hydrochloride? |
| A: CAS number of 5-Phenylisoindoline hydrochloride is 910237-77-3. |
| Q: What is the English name of 5-Phenylisoindoline hydrochloride? |
| A: The English name of 5-Phenylisoindoline hydrochloride is 5-Phenylisoindoline hydrochloride. |
| Q: What is the molecular weight of 5-Phenylisoindoline hydrochloride? |
| A: Molecular weight of 5-Phenylisoindoline hydrochloride is 231.72. |