1,3-bis(2,4,6-tribromophenoxy)propan-2-ol structure
|
Common Name | 1,3-bis(2,4,6-tribromophenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 91037-61-5 | Molecular Weight | 717.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10Br6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(2,4,6-tribromophenoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10Br6O3 |
|---|---|
| Molecular Weight | 717.66200 |
| Exact Mass | 711.57300 |
| PSA | 38.69000 |
| LogP | 7.08030 |
| InChIKey | NFBCXIHAPSKYNY-UHFFFAOYSA-N |
| SMILES | OC(COc1c(Br)cc(Br)cc1Br)COc1c(Br)cc(Br)cc1Br |
|
~%
1,3-bis(2,4,6-t... CAS#:91037-61-5 |
| Literature: Marle Journal of the Chemical Society, 1912 , vol. 101, p. 309 |
|
~%
Detail
|
| Literature: Marle Journal of the Chemical Society, 1912 , vol. 101, p. 309 |
| 2-Propanol,1,3-bis(2,4,6-tribromophenoxy) |
| 1,3-Bis-(2,4,6-tribrom-phenoxy)-propan-2-ol |
| 1,3-bis-(2,4,6-tribromo-phenoxy)-propan-2-ol |