1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride
Modify Date: 2025-09-05 16:53:27
1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride structure
|
Common Name | 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 910409-22-2 | Molecular Weight | 225.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11ClF3N |
|---|---|
| Molecular Weight | 225.64 |
| InChIKey | ZVIHRELILMAJNU-UHFFFAOYSA-N |
| SMILES | CC(N)Cc1c(F)cc(F)cc1F.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: InChIKey of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is ZVIHRELILMAJNU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: Molecular weight of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is 225.64. |
| Q: What is the Chinese name of 910409-22-2? |
| A: Chinese name of 910409-22-2 is 910409-22-2. |
| Q: What is the SMILES notation of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: SMILES notation of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is CC(N)Cc1c(F)cc(F)cc1F.Cl. |
| Q: What is the molecular formula of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: Molecular formula of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is C9H11ClF3N. |
| Q: What is the English name of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: The English name of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride. |
| Q: What is the CAS number of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride? |
| A: CAS number of 1-(2,4,6-Trifluorphenyl)propan-2-amine hydrochloride is 910409-22-2. |