((4-((4-FLUOROPHENYL)ETHYNYL)PHENYL)ETHYNYL)TRIMETHYLSILANE structure
|
Common Name | ((4-((4-FLUOROPHENYL)ETHYNYL)PHENYL)ETHYNYL)TRIMETHYLSILANE | ||
|---|---|---|---|---|
| CAS Number | 910467-79-7 | Molecular Weight | 292.422 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 358.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C19H17FSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7±27.9 °C | |
| Name | 2-[4-[2-(4-fluorophenyl)ethynyl]phenyl]ethynyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.6±42.0 °C at 760 mmHg |
| Molecular Formula | C19H17FSi |
| Molecular Weight | 292.422 |
| Flash Point | 170.7±27.9 °C |
| Exact Mass | 292.108368 |
| LogP | 7.07 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | XBFCWOQPNQXDMH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1ccc(C#Cc2ccc(F)cc2)cc1 |
|
~98%
((4-((4-FLUOROP... CAS#:910467-79-7 |
| Literature: Zhi, Yong-Gang; Lai, Siu-Wai; Chan, Queenie K.-W.; Law, Yuen-Chi; Tong, Glenna S.-M.; Che, Chi-Ming European Journal of Organic Chemistry, 2006 , # 14 p. 3125 - 3139 |
|
~%
((4-((4-FLUOROP... CAS#:910467-79-7 |
| Literature: Zhi, Yong-Gang; Lai, Siu-Wai; Chan, Queenie K.-W.; Law, Yuen-Chi; Tong, Glenna S.-M.; Che, Chi-Ming European Journal of Organic Chemistry, 2006 , # 14 p. 3125 - 3139 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| ({4-[(4-Fluorophenyl)ethynyl]phenyl}ethynyl)(trimethyl)silane |
| ((4-((4-Fluorophenyl)ethynyl)phenyl)ethynyl)trimethylsilane |
| Benzene, 1-fluoro-4-[2-[4-[2-(trimethylsilyl)ethynyl]phenyl]ethynyl]- |