4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol
Modify Date: 2026-05-19 22:20:20
![4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol Structure](https://www.chemsrc.com/extcaspic/041/91058-99-0.png)
4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol structure
|
Common Name | 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol | ||
|---|---|---|---|---|
| CAS Number | 91058-99-0 | Molecular Weight | 272.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7Cl2NOS |
|---|---|
| Molecular Weight | 272.1 |
| InChIKey | PYPHCUQMUTZAIN-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Cc2cc(Cl)c(Cl)s2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: CAS number of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is 91058-99-0. |
| Q: What is the Chinese name of 91058-99-0? |
| A: Chinese name of 91058-99-0 is 91058-99-0. |
| Q: What is the English name of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: The English name of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol. |
| Q: What is the molecular formula of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: Molecular formula of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is C11H7Cl2NOS. |
| Q: What is the InChIKey of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: InChIKey of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is PYPHCUQMUTZAIN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: Molecular weight of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is 272.1. |
| Q: What is the SMILES notation of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol? |
| A: SMILES notation of 4-[[(4,5-Dichloro-2-thienyl)methylene]amino]phenol is Oc1ccc(N=Cc2cc(Cl)c(Cl)s2)cc1. |