Methyl 3-hydroxy-4,5-dimethylbenzoate
Modify Date: 2025-09-12 11:47:24
Methyl 3-hydroxy-4,5-dimethylbenzoate structure
|
Common Name | Methyl 3-hydroxy-4,5-dimethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 91061-37-9 | Molecular Weight | 180.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-hydroxy-4,5-dimethylbenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12O3 |
|---|---|
| Molecular Weight | 180.20 |
| InChIKey | WRXQUHHOMXXQCK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)c(C)c(O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: InChIKey of Methyl 3-hydroxy-4,5-dimethylbenzoate is WRXQUHHOMXXQCK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 91061-37-9? |
| A: Chinese name of 91061-37-9 is 91061-37-9. |
| Q: What is the SMILES notation of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: SMILES notation of Methyl 3-hydroxy-4,5-dimethylbenzoate is COC(=O)c1cc(C)c(C)c(O)c1. |
| Q: What is the molecular weight of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: Molecular weight of Methyl 3-hydroxy-4,5-dimethylbenzoate is 180.20. |
| Q: What is the English name of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: The English name of Methyl 3-hydroxy-4,5-dimethylbenzoate is Methyl 3-hydroxy-4,5-dimethylbenzoate. |
| Q: What is the CAS number of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: CAS number of Methyl 3-hydroxy-4,5-dimethylbenzoate is 91061-37-9. |
| Q: What is the molecular formula of Methyl 3-hydroxy-4,5-dimethylbenzoate? |
| A: Molecular formula of Methyl 3-hydroxy-4,5-dimethylbenzoate is C10H12O3. |