2,6-dichloro-N-methyl-N-phenylpyrimidin-4-amine structure
|
Common Name | 2,6-dichloro-N-methyl-N-phenylpyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 91064-29-8 | Molecular Weight | 254.11500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dichloro-N-methyl-N-phenylpyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9Cl2N3 |
|---|---|
| Molecular Weight | 254.11500 |
| Exact Mass | 253.01700 |
| PSA | 29.02000 |
| LogP | 3.55130 |
| InChIKey | QUVADLWDSDBZDK-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1cc(Cl)nc(Cl)n1 |
| HS Code | 2933599090 |
|---|
|
~%
2,6-dichloro-N-... CAS#:91064-29-8 |
| Literature: King et al. Journal of the Chemical Society, 1947 , p. 1247 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Dichlor-4-(N-methyl-anilino)-pyrimidin |
| (2,6-Dichlor-pyrimidin-4-yl)-methyl-phenyl-amin |
| (2,6-dichloro-pyrimidin-4-yl)-methyl-phenyl-amine |