dimethyl(phenyl)silicon,zinc
dimethyl(phenyl)silicon,zinc structure
|
Common Name | dimethyl(phenyl)silicon,zinc | ||
|---|---|---|---|---|
| CAS Number | 91076-08-3 | Molecular Weight | 335.89700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22Si2Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Dimethyl(phenyl)silicon, zinc, a有机化合物，Chinese name: 二甲基苯基硅锌，CAS number: 91076-08-3，molecular formula: C16H22Si2Zn，molecular weight: 335.89700。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl(phenyl)silicon,zinc |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22Si2Zn |
|---|---|
| Molecular Weight | 335.89700 |
| Exact Mass | 334.05500 |
| LogP | 3.29350 |
| InChIKey | YPNJEZOSOUMYNR-UHFFFAOYSA-N |
| SMILES | C[Si](C)c1ccccc1.C[Si](C)c1ccccc1.[Zn] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Zn(SiMe2Ph)2 |
| bis(dimethylphenylsilyl)zinc |
| (Me2PhSi)2Zn |
| (PhMe2Si)2Zn |
| Zinc,bis(dimethylphenylsilyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does dimethyl(phenyl)silicon,zinc have? |
| A: English synonyms of dimethyl(phenyl)silicon,zinc: Zn(SiMe2Ph)2, bis(dimethylphenylsilyl)zinc, (Me2PhSi)2Zn, (PhMe2Si)2Zn, Zinc,bis(dimethylphenylsilyl). |
| Q: What is the CAS number of dimethyl(phenyl)silicon,zinc? |
| A: CAS number of dimethyl(phenyl)silicon,zinc is 91076-08-3. |
| Q: What is the molecular weight of dimethyl(phenyl)silicon,zinc? |
| A: Molecular weight of dimethyl(phenyl)silicon,zinc is 335.89700. |
| Q: What is the molecular formula of dimethyl(phenyl)silicon,zinc? |
| A: Molecular formula of dimethyl(phenyl)silicon,zinc is C16H22Si2Zn. |
| Q: What is the InChIKey of dimethyl(phenyl)silicon,zinc? |
| A: InChIKey of dimethyl(phenyl)silicon,zinc is YPNJEZOSOUMYNR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of dimethyl(phenyl)silicon,zinc? |
| A: SMILES notation of dimethyl(phenyl)silicon,zinc is C[Si](C)c1ccccc1.C[Si](C)c1ccccc1.[Zn]. |
| Q: What is the English name of dimethyl(phenyl)silicon,zinc? |
| A: The English name of dimethyl(phenyl)silicon,zinc is dimethyl(phenyl)silicon,zinc. |
| Q: What is the Chinese name of 91076-08-3? |
| A: Chinese name of 91076-08-3 is 91076-08-3. |
| Q: What is the LogP of dimethyl(phenyl)silicon,zinc? |
| A: LogP of dimethyl(phenyl)silicon,zinc is 3.29350. |