[2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium
![[2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium Structure](https://image.chemsrc.com/caspic/434/91076-86-7.png)
[2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium structure
|
Common Name | [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium | ||
|---|---|---|---|---|
| CAS Number | 91076-86-7 | Molecular Weight | 255.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Chinese name: [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium；English name: [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium；CAS number: 91076-86-7；Molecular formula: C12H16O4P+；Molecular weight: 255.22700；For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O4P+ |
|---|---|
| Molecular Weight | 255.22700 |
| Exact Mass | 255.07900 |
| PSA | 86.74000 |
| LogP | 2.65220 |
| InChIKey | KQUNVCIZECZTNC-UHFFFAOYSA-N |
| SMILES | CO[P+](=O)c1ccccc1OC(=O)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-(2,2-dimethy... CAS#:91076-86-7 |
| Literature: Heinicke, Joachim; Tzschach, Alfred Zeitschrift fuer Chemie (Stuttgart, Germany), 1983 , vol. 23, # 12 p. 439 - 440 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanoic acid,2,2-dimethyl-,2-(methoxyphosphinyl)phenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: SMILES notation of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is CO[P+](=O)c1ccccc1OC(=O)C(C)(C)C. |
| Q: What English synonyms does [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium have? |
| A: English synonyms of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium: Propanoic acid,2,2-dimethyl-,2-(methoxyphosphinyl)phenyl ester. |
| Q: What is the LogP of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: LogP of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is 2.65220. |
| Q: What is the English name of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: The English name of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium. |
| Q: What is the molecular weight of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: Molecular weight of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is 255.22700. |
| Q: What is the InChIKey of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: InChIKey of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is KQUNVCIZECZTNC-UHFFFAOYSA-N. |
| Q: What is the CAS number of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: CAS number of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is 91076-86-7. |
| Q: What is the polar surface area (PSA) of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: Polar surface area (PSA) of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is 86.74000. |
| Q: What is the Chinese name of 91076-86-7? |
| A: Chinese name of 91076-86-7 is 91076-86-7. |
| Q: What is the molecular formula of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium? |
| A: Molecular formula of [2-(2,2-dimethylpropanoyloxy)phenyl]-methoxy-oxophosphanium is C12H16O4P+. |