3-AMINO-5-(4-NITROPHENYL)THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER
3-AMINO-5-(4-NITROPHENYL)THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER structure
|
Common Name | 3-AMINO-5-(4-NITROPHENYL)THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 91076-99-2 | Molecular Weight | 278.28400 | |
| Density | 1.418g/cm3 | Boiling Point | 516.9ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O4S | Melting Point | 220-222ºC | |
| MSDS | N/A | Flash Point | 266.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 516.9ºC at 760 mmHg |
| Melting Point | 220-222ºC |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.28400 |
| Flash Point | 266.4ºC |
| Exact Mass | 278.03600 |
| PSA | 126.38000 |
| LogP | 3.79650 |
| Index of Refraction | 1.652 |
| InChIKey | NVUFFVPGEHZJFW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc(-c2ccc([N+](=O)[O-])cc2)cc1N |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-AMINO-5-(4-NI... CAS#:91076-99-2 |
| Literature: Hartmann, Horst; Liebscher, Juergen Synthesis, 1984 , # 3 p. 275 - 276 |
|
~%
3-AMINO-5-(4-NI... CAS#:91076-99-2 |
| Literature: Hertzog, Donald L.; Al-Barazanji, Kamal A.; Bigham, Eric C.; Bishop, Michael J.; Britt, Christy S.; Carlton, David L.; Cooper, Joel P.; Daniels, Alex J.; Garrido, Dulce M.; Goetz, Aaron S.; Grizzle, Mary K.; Guo, Yu C.; Handlon, Anthony L.; Ignar, Diane M.; Morgan, Ronda O.; Peat, Andrew J.; Tavares, Francis X.; Zhou, Huiqiang Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 18 p. 4723 - 4727 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Molecular formula of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is C12H10N2O4S. |
| Q: What are the upstream materials of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Related upstream materials(CAS) of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate: 78583-88-7;2365-48-2;100-19-6. |
| Q: What is the InChIKey of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: InChIKey of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is NVUFFVPGEHZJFW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Polar surface area (PSA) of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 126.38000. |
| Q: What is the CAS number of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: CAS number of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 91076-99-2. |
| Q: What is the LogP of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: LogP of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 3.79650. |
| Q: What is the boiling point of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Boiling point of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 516.9ºC at 760 mmHg. |
| Q: What is the melting point of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Melting point of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 220-222ºC. |
| Q: What is the SMILES notation of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: SMILES notation of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is COC(=O)c1sc(-c2ccc([N+](=O)[O-])cc2)cc1N. |
| Q: What is the molecular weight of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate? |
| A: Molecular weight of methyl 3-amino-5-(4-nitrophenyl)thiophene-2-carboxylate is 278.28400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |