4-ethyl-3,3-dimethyl-1-phenylmethoxyazetidin-2-one structure
|
Common Name | 4-ethyl-3,3-dimethyl-1-phenylmethoxyazetidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 91078-06-7 | Molecular Weight | 233.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-3,3-dimethyl-1-phenylmethoxyazetidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO2 |
|---|---|
| Molecular Weight | 233.30600 |
| Exact Mass | 233.14200 |
| PSA | 29.54000 |
| LogP | 2.70310 |
| InChIKey | IMWQURZWWOKVPC-UHFFFAOYSA-N |
| SMILES | CCC1N(OCc2ccccc2)C(=O)C1(C)C |
|
~41%
4-ethyl-3,3-dim... CAS#:91078-06-7 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
|
~%
4-ethyl-3,3-dim... CAS#:91078-06-7 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
| 2-Azetidinone,4-ethyl-3,3-dimethyl-1-(phenylmethoxy) |