N-(2-Chloro-6-methyl-phenyl)-3-oxo-butyramide
Modify Date: 2025-08-30 08:25:53
N-(2-Chloro-6-methyl-phenyl)-3-oxo-butyramide structure
|
Common Name | N-(2-Chloro-6-methyl-phenyl)-3-oxo-butyramide | ||
|---|---|---|---|---|
| CAS Number | 91089-62-2 | Molecular Weight | 225.67100 | |
| Density | 1.247g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | N-(2-chloro-6-methylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 185.2ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.63900 |
| Index of Refraction | 1.572 |
| InChIKey | NRVXULLHSFITHB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)Nc1c(C)cccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-Chloro-6-m... CAS#:91089-62-2 |
| Literature: DE256621 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 159 |
|
~%
N-(2-Chloro-6-m... CAS#:91089-62-2 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 36, p. 492 - 500 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-Chloro-6-methyl-phenyl)-3-oxo-butyramide |
| 1-Acetoacetylamino-2-chlor-6-methyl-benzol |
| Acetessigsaeure-(2-chlor-6-methyl-anilid) |
| N-(2-chloro-6-methylphenyl)-3-oxo-butanamide |
| acetoacetic acid-(2-chloro-6-methyl-anilide) |
| 6-CHLORO-O-ACETACETOTOLUIDIDE |