Urea,N'-(4-chlorophenyl)-N-(2-cyanoethyl)-N-methyl- structure
|
Common Name | Urea,N'-(4-chlorophenyl)-N-(2-cyanoethyl)-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 91090-02-7 | Molecular Weight | 237.68500 | |
| Density | 1.287g/cm3 | Boiling Point | 470.7ºC at 760mmHg | |
| Molecular Formula | C11H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | 3-(4-chlorophenyl)-1-(2-cyanoethyl)-1-methylurea |
|---|
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 470.7ºC at 760mmHg |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.68500 |
| Flash Point | 238.5ºC |
| Exact Mass | 237.06700 |
| PSA | 56.13000 |
| LogP | 2.79038 |
| Index of Refraction | 1.597 |
| InChIKey | PBMWGXVQBXUFOO-UHFFFAOYSA-N |
| SMILES | CN(CCC#N)C(=O)Nc1ccc(Cl)cc1 |
|
~96%
Urea,N'-(4-chlo... CAS#:91090-02-7 |
| Literature: Schneider, Peter; Goodrow, Marvin H.; Gee, Shirley J.; Hammock, Bruce D. Journal of Agricultural and Food Chemistry, 1994 , vol. 42, # 2 p. 413 - 422 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |