2,6-Pyridinediamine,3-[2-(4-chlorophenyl)diazenyl]- structure
|
Common Name | 2,6-Pyridinediamine,3-[2-(4-chlorophenyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 91092-14-7 | Molecular Weight | 247.68400 | |
| Density | 1.45g/cm3 | Boiling Point | 480.9ºC at 760mmHg | |
| Molecular Formula | C11H10ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.6ºC | |
| Name | 3-[(4-chlorophenyl)diazenyl]pyridine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 480.9ºC at 760mmHg |
| Molecular Formula | C11H10ClN5 |
| Molecular Weight | 247.68400 |
| Flash Point | 244.6ºC |
| Exact Mass | 247.06200 |
| PSA | 89.65000 |
| LogP | 4.47720 |
| Index of Refraction | 1.701 |
| InChIKey | KUIDVWPVPZWITR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N=Nc2ccc(Cl)cc2)c(N)n1 |
|
~%
2,6-Pyridinedia... CAS#:91092-14-7 |
| Literature: Timmis et al. Journal of Pharmacy and Pharmacology, 1957 , vol. 9, p. 46,54 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(4-chloro-phenylazo)-pyridine-2,6-diyldiamine |
| 3-(4-Chlor-phenylazo)-pyridin-2,6-diyldiamin |
| 2,6-Diamino-3-(4'-chlorphenylazo)-pyridin |