4,6-dimethoxy-3-oxo-1H-2-benzofuran-1-carboxylic acid structure
|
Common Name | 4,6-dimethoxy-3-oxo-1H-2-benzofuran-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 91099-16-0 | Molecular Weight | 238.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dimethoxy-3-oxo-1H-2-benzofuran-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10O6 |
|---|---|
| Molecular Weight | 238.19300 |
| Exact Mass | 238.04800 |
| PSA | 82.06000 |
| LogP | 0.99990 |
| InChIKey | HLGPZKKHSRVKEL-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)C(C(=O)O)OC2=O |
|
~54%
4,6-dimethoxy-3... CAS#:91099-16-0 |
| Literature: Ni, Jizhi; Xiao, Heping; Weng, Lipeng; Wei, Xiaofeng; Xu, Youjun Tetrahedron, 2011 , vol. 67, # 29 p. 5162 - 5167 |
|
~%
4,6-dimethoxy-3... CAS#:91099-16-0 |
| Literature: Barger; Sargent Journal of the Chemical Society, 1939 , p. 991,995 |
| 4,6-dimethoxy-3-oxo-phthalan-1-carboxylic acid |
| 1-Isobenzofurancarboxylic acid,1,3-dihydro-4,6-dimethoxy-3-oxo |
| 4,6-Dimethoxy-3-oxo-phthalan-1-carbonsaeure |
| 1,3-dihydro-5,7-dimethoxy-3-oxo-1-isobenzofurancarboxylic acid |
| 5,7-dimethoxy-3-oxo-1,3-dihydroisobenzofuran-1-carboxylic acid |
| 3,5-Dimethoxyphthalidsaeure |