Boc-D-Alanine Methyl Ester structure
|
Common Name | Boc-D-Alanine Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 91103-47-8 | Molecular Weight | 203.236 | |
| Density | 1.051±0.06 g/cm3 | Boiling Point | 277.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | 34-37ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 121.8±22.6 °C | |
| Name | Boc-D-Alanine Methyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051±0.06 g/cm3 |
|---|---|
| Boiling Point | 277.8±23.0 °C at 760 mmHg |
| Melting Point | 34-37ºC(lit.) |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.236 |
| Flash Point | 121.8±22.6 °C |
| Exact Mass | 203.115753 |
| PSA | 64.63000 |
| LogP | 1.56 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.439 |
| InChIKey | GJDICGOCZGRDFM-ZCFIWIBFSA-N |
| SMILES | COC(=O)C(C)NC(=O)OC(C)(C)C |
| Water Solubility | Slightly soluble (8.7 g/L) (25 ºC) |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-alaninate |
| boc-n-me-r-ala-oh |
| BOC-N-methyl-D-alanine |
| N-(tert-butyloxycarbonyl)-N-methyl-D-alanine |
| boc-d-meala-oh |
| Boc-D-N-Me-Ala-OH |
| Boc-Me-D-Ala-OH |
| N-Boc-N-methyl-D-alanine |
| AmbotzBAA1043 |
| (R)-2-(tert-butoxycarbonyl-methyl-amino)-propionic acid |
| N-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-alanine |
| N-methyl-N-tert-butoxycarbonyl-D-alanine |
| MFCD00191865 |
| D-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester |
| Boc-D-Me-Ala-OH |
| N-(tert-Butoxycarbonyl)-N-methyl-D-alanine |
| Boc-Nalpha-methyl-D-alanine |
| methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| Boc-N-Me-D-Ala-OH |
| Methyl N-(tert-butoxycarbonyl)-D-alaninate |
| N-t-BOC-N-methyl-D-alanine |
| N-(tert-Butoxycarbonyl)-D-alanine methyl ester |
| Boc-D-Ala-OMe |