ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate structure
|
Common Name | ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 911047-42-2 | Molecular Weight | 238.23700 | |
| Density | 1.159g/cm3 | Boiling Point | 365.8ºC at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 162.3ºC | |
| Name | ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 365.8ºC at 760 mmHg |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.23700 |
| Flash Point | 162.3ºC |
| Exact Mass | 238.08400 |
| PSA | 61.83000 |
| LogP | 1.44960 |
| Index of Refraction | 1.502 |
| InChIKey | ZFXDELRBPYIPAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1cc(OC)ccc1OC |
| HS Code | 2918990090 |
|---|
|
~95%
ethyl 2-(2,5-di... CAS#:911047-42-2 |
| Literature: Ianni, Alen; Waldvogel, Siegfried R. Synthesis, 2006 , # 13 p. 2103 - 2112 |
|
~%
ethyl 2-(2,5-di... CAS#:911047-42-2 |
| Literature: Chimica Therapeutica, , vol. 1, p. 408 - 414 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ETHYL 2,5-DIMETHOXYBENZOYLFORMATE |
| (2,5-Dimethoxyphenyl)-glyoxylsaeure-ethylester |
| (2,5-dimethoxy-phenyl)-glyoxylic acid ethyl ester |
| (2,5-Dimethoxy-phenyl)-glyoxylsaeure-aethylester |