10-O-(3-carboxypropyl)ractopamine ether
Modify Date: 2025-09-10 14:08:16
10-O-(3-carboxypropyl)ractopamine ether structure
|
Common Name | 10-O-(3-carboxypropyl)ractopamine ether | ||
|---|---|---|---|---|
| CAS Number | 911196-29-7 | Molecular Weight | 387.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-O-(3-carboxypropyl)ractopamine ether |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H29NO5 |
|---|---|
| Molecular Weight | 387.5 |
| InChIKey | TXPQZOXMDVOMOU-UHFFFAOYSA-N |
| SMILES | CC(CCc1ccc(OCCCC(=O)O)cc1)NCC(O)c1ccc(O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 911196-29-7? |
| A: Chinese name of 911196-29-7 is 911196-29-7. |
| Q: What is the InChIKey of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: InChIKey of 10-O-(3-carboxypropyl)ractopamine ether is TXPQZOXMDVOMOU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: CAS number of 10-O-(3-carboxypropyl)ractopamine ether is 911196-29-7. |
| Q: What is the SMILES notation of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: SMILES notation of 10-O-(3-carboxypropyl)ractopamine ether is CC(CCc1ccc(OCCCC(=O)O)cc1)NCC(O)c1ccc(O)cc1. |
| Q: What is the English name of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: The English name of 10-O-(3-carboxypropyl)ractopamine ether is 10-O-(3-carboxypropyl)ractopamine ether. |
| Q: What is the molecular formula of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: Molecular formula of 10-O-(3-carboxypropyl)ractopamine ether is C22H29NO5. |
| Q: What is the molecular weight of 10-O-(3-carboxypropyl)ractopamine ether? |
| A: Molecular weight of 10-O-(3-carboxypropyl)ractopamine ether is 387.5. |