Piperidyl-quinine
Modify Date: 2025-09-05 18:45:32
Piperidyl-quinine structure
|
Common Name | Piperidyl-quinine | ||
|---|---|---|---|---|
| CAS Number | 911671-83-5 | Molecular Weight | 407.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Piperidyl-quinine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H33N3O2 |
|---|---|
| Molecular Weight | 407.5 |
| InChIKey | MJTPSOJJBNVJQO-ZLTRHKIISA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1cc(N2CCCCC2)nc2ccc(OC)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Piperidyl-quinine? |
| A: Molecular weight of Piperidyl-quinine is 407.5. |
| Q: What is the SMILES notation of Piperidyl-quinine? |
| A: SMILES notation of Piperidyl-quinine is C=CC1CN2CCC1CC2C(O)c1cc(N2CCCCC2)nc2ccc(OC)cc12. |
| Q: What is the CAS number of Piperidyl-quinine? |
| A: CAS number of Piperidyl-quinine is 911671-83-5. |
| Q: What is the Chinese name of 911671-83-5? |
| A: Chinese name of 911671-83-5 is 911671-83-5. |
| Q: What is the molecular formula of Piperidyl-quinine? |
| A: Molecular formula of Piperidyl-quinine is C25H33N3O2. |
| Q: What is the English name of Piperidyl-quinine? |
| A: The English name of Piperidyl-quinine is Piperidyl-quinine. |
| Q: What is the InChIKey of Piperidyl-quinine? |
| A: InChIKey of Piperidyl-quinine is MJTPSOJJBNVJQO-ZLTRHKIISA-N. |