2,4-dimethylphenothiazin-3-one structure
|
Common Name | 2,4-dimethylphenothiazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 91173-15-8 | Molecular Weight | 241.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethylphenothiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NOS |
|---|---|
| Molecular Weight | 241.30800 |
| Exact Mass | 241.05600 |
| PSA | 58.20000 |
| LogP | 3.37810 |
| InChIKey | WKODUDQVYXNDMM-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc3ccccc3sc-2c(C)c1=O |
|
~7%
2,4-dimethylphe... CAS#:91173-15-8 |
| Literature: Ueno Pharmazie, 1984 , vol. 39, # 5 p. 355 - 356 |
|
~31%
2,4-dimethylphe... CAS#:91173-15-8 |
| Literature: Ueno Pharmazie, 1984 , vol. 39, # 5 p. 355 - 356 |
|
~%
2,4-dimethylphe... CAS#:91173-15-8 |
| Literature: Hasegawa, Kan-ichi; Ueno, Yoshio Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 2 p. 510 - 517 |
| 2,4-Dimethyl-3H-phenothiazin-3-one |
| 3H-Phenothiazin-3-one,2,4-dimethyl |