Harzianolide
Modify Date: 2026-09-02 20:23:28
Harzianolide structure
|
Common Name | Harzianolide | ||
|---|---|---|---|---|
| CAS Number | 911809-23-9 | Molecular Weight | 222.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Harzianolide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O3 |
|---|---|
| Molecular Weight | 222.28 |
| InChIKey | KELRJXQJITUJOU-VNKDHWASSA-N |
| SMILES | CC=CC=CCC1=C(CC(C)O)C(=O)OC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 21, Current Page 1 of 3
1
2
3
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 911809-23-9? |
| A: Chinese name of 911809-23-9 is 911809-23-9. |
| Q: What is the SMILES notation of Harzianolide? |
| A: SMILES notation of Harzianolide is CC=CC=CCC1=C(CC(C)O)C(=O)OC1. |
| Q: What is the molecular formula of Harzianolide? |
| A: Molecular formula of Harzianolide is C13H18O3. |
| Q: What is the CAS number of Harzianolide? |
| A: CAS number of Harzianolide is 911809-23-9. |
| Q: What is the InChIKey of Harzianolide? |
| A: InChIKey of Harzianolide is KELRJXQJITUJOU-VNKDHWASSA-N. |
| Q: What is the molecular weight of Harzianolide? |
| A: Molecular weight of Harzianolide is 222.28. |
| Q: What is the English name of Harzianolide? |
| A: The English name of Harzianolide is Harzianolide. |