5-(Benzyloxy)-2,4-dichloropyrimidine structure
|
Common Name | 5-(Benzyloxy)-2,4-dichloropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 91183-17-4 | Molecular Weight | 255.100 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 381.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6±23.7 °C | |
| Name | 5-(Benzyloxy)-2,4-dichloropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.6±27.0 °C at 760 mmHg |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.100 |
| Flash Point | 184.6±23.7 °C |
| Exact Mass | 254.001373 |
| PSA | 35.01000 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | HICKLOUBWJHHFE-UHFFFAOYSA-N |
| SMILES | Clc1ncc(OCc2ccccc2)c(Cl)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrimidine, 2,4-dichloro-5-(phenylmethoxy)- |
| 2,4-dichloro-5-phenylmethoxypyrimidine |
| 5-(Benzyloxy)-2,4-dichloropyrimidine |