tert-Butyl 1-benzhydryl-3-azetidinylcarbamate structure
|
Common Name | tert-Butyl 1-benzhydryl-3-azetidinylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 91189-18-3 | Molecular Weight | 338.443 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 448.8±34.0 °C at 760 mmHg | |
| Molecular Formula | C21H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2±25.7 °C | |
| Name | tert-Butyl (1-benzhydrylazetidin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 448.8±34.0 °C at 760 mmHg |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.443 |
| Flash Point | 225.2±25.7 °C |
| Exact Mass | 338.199432 |
| PSA | 41.57000 |
| LogP | 3.96 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | BIVZFVCCXSAZAR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CN(C(c2ccccc2)c2ccccc2)C1 |
| HS Code | 2933990090 |
|---|
|
~%
tert-Butyl 1-be... CAS#:91189-18-3 |
| Literature: WO2004/112793 A1, ; Page/Page column 146 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl [1-(diphenylmethyl)azetidin-3-yl]carbamate |
| 2-Methyl-2-propanyl [1-(diphenylmethyl)-3-azetidinyl]carbamate |
| tert-butyl N-(1-benzhydrylazetidin-3-yl)carbamate |
| tert-Butyl-[1-(diphenylmethyl)azetidin-3-yl]carbamat |
| Carbamic acid, N-[1-(diphenylmethyl)-3-azetidinyl]-, 1,1-dimethylethyl ester |