ethyl 2-(4-ethoxycarbonylquinolin-2-yl)quinoline-4-carboxylate structure
|
Common Name | ethyl 2-(4-ethoxycarbonylquinolin-2-yl)quinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 912-84-5 | Molecular Weight | 400.42700 | |
| Density | 1.258g/cm3 | Boiling Point | 586.2ºC at 760 mmHg | |
| Molecular Formula | C24H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.3ºC | |
| Name | ethyl 2-(4-ethoxycarbonylquinolin-2-yl)quinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 586.2ºC at 760 mmHg |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.42700 |
| Flash Point | 308.3ºC |
| Exact Mass | 400.14200 |
| PSA | 78.38000 |
| LogP | 4.80340 |
| Index of Refraction | 1.646 |
| InChIKey | MHTKEFREHDUDMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(-c2cc(C(=O)OCC)c3ccccc3n2)nc2ccccc12 |
|
~82%
ethyl 2-(4-etho... CAS#:912-84-5 |
| Literature: Hoertz, Paul G.; Staniszewski, Aaron; Marton, Andras; Higgins, Gerard T.; Incarvito, Christopher D.; Rheingold, Arnold L.; Meyer, Gerald J. Journal of the American Chemical Society, 2006 , vol. 128, # 25 p. 8234 - 8245 |
|
~%
ethyl 2-(4-etho... CAS#:912-84-5 |
| Literature: Brown et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2705,2707 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2'-Bi-ethylcinchoninate |
| diethyl 2,2-biquinoline-4,4'-dicarboxylic acid |
| [2,2']biquinolyl-4,4'-dicarboxylic acid diethyl ester |
| [2,2']biquinolinyl-4,4'-dicarboxylic acid diethyl ester |
| 2,2'-biquinoline-4,4'-dicarboxylic acid diethyl ester |
| 4,4'-bis(ethoxycarbonyl)-2,2-biquinoline |