(E and Z)-2-(5-chloro-2-phenoxy-phenyl)-3-hydroxy-acrylic acid methyl ester structure
|
Common Name | (E and Z)-2-(5-chloro-2-phenoxy-phenyl)-3-hydroxy-acrylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 912356-01-5 | Molecular Weight | 304.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E and Z)-2-(5-chloro-2-phenoxy-phenyl)-3-hydroxy-acrylic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13ClO4 |
|---|---|
| Molecular Weight | 304.72500 |
| Exact Mass | 304.05000 |
| PSA | 55.76000 |
| LogP | 4.20420 |
| InChIKey | VWIIMLDFDYFOBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=CO)c1cc(Cl)ccc1Oc1ccccc1 |
| 2-(5-chloro-2-phenoxy-phenyl)-3-hydroxy-acrylic acid methyl ester |
| methyl 2-(5-chloro-2-phenoxyphenyl)-3-hydroxyacrylate |