Boc-Pyr-OtBu
Modify Date: 2025-10-06 08:30:25
Boc-Pyr-OtBu structure
|
Common Name | Boc-Pyr-OtBu | ||
|---|---|---|---|---|
| CAS Number | 91237-84-2 | Molecular Weight | 285.33600 | |
| Density | 1.138g/cm3 | Boiling Point | 390.663°C at 760 mmHg | |
| Molecular Formula | C14H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.067°C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 390.663°C at 760 mmHg |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.33600 |
| Flash Point | 190.067°C |
| Exact Mass | 285.15800 |
| PSA | 72.91000 |
| LogP | 2.19210 |
| InChIKey | UMCYLERMBHATJC-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)C1CCCN1C(=O)OC(C)(C)C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (S)-(-)-1,2,3,4-Tetrahydro-|A,|A-diphenyl-3-isoquinolinemethanol |
| tert-butyl N-(tert-butoxycarbonyl)-L-prolinate |
| tert-butyl-L-1-tert-butoxycarbonylprolinate |
| (S)-diphenyl(1-methylpyrrolidin-2-yl)methanol |
| (S)-di-tert-butylpyrrolidine-1,2-dicarboxylate |
| (S)-(+)-DPMPM |
| (2'S)-(+)-diphenyl(1'-methylpyrrolidin-2'-yl)methanol |
| (S)-diphenyl(1,2,3,4-tetrahydroisoquinolin-3-yl)methanol |
| N-t-butyloxycarbonyl-L-proline t-butyl ester |
| tert-butyl (2S)-N-tert-butoxycarbonylprolinate |
| Bis(tert-Butyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| Boc-Pyr-OtBu |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: Molecular formula of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is C14H23NO5. |
| Q: What is the polar surface area (PSA) of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: Polar surface area (PSA) of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is 72.91000. |
| Q: What is the molecular weight of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: Molecular weight of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is 285.33600. |
| Q: What is the boiling point of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: Boiling point of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is 390.663°C at 760 mmHg. |
| Q: What is the InChIKey of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: InChIKey of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is UMCYLERMBHATJC-JTQLQIEISA-N. |
| Q: What is the CAS number of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: CAS number of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is 91237-84-2. |
| Q: What is the English name of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: The English name of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate. |
| Q: What is the LogP of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: LogP of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is 2.19210. |
| Q: What is the SMILES notation of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate? |
| A: SMILES notation of Bis(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate is CC(C)(C)OC(=O)C1CCCN1C(=O)OC(C)(C)C. |