4-(bromomethyl)-1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole structure
|
Common Name | 4-(bromomethyl)-1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole | ||
|---|---|---|---|---|
| CAS Number | 912569-72-3 | Molecular Weight | 335.12000 | |
| Density | 1.54g/cm3 | Boiling Point | 335.8ºC at 760 mmHg | |
| Molecular Formula | C12H10BrF3N2O | Melting Point | 75.5-77.5ºC | |
| MSDS | N/A | Flash Point | 156.9ºC | |
| Name | 4-(bromomethyl)-1-methyl-5-phenoxy-3-(trifluoromethyl)pyrazole |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 335.8ºC at 760 mmHg |
| Melting Point | 75.5-77.5ºC |
| Molecular Formula | C12H10BrF3N2O |
| Molecular Weight | 335.12000 |
| Flash Point | 156.9ºC |
| Exact Mass | 333.99300 |
| PSA | 27.05000 |
| LogP | 4.12610 |
| Index of Refraction | 1.546 |
| InChIKey | ZPLVOLPZNXRNTB-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(F)(F)F)c(CBr)c1Oc1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |