N-Ethyl-N-methyl-2-(1-piperazinyl)nicotinamide structure
|
Common Name | N-Ethyl-N-methyl-2-(1-piperazinyl)nicotinamide | ||
|---|---|---|---|---|
| CAS Number | 912761-62-7 | Molecular Weight | 248.32400 | |
| Density | 1.114g/cm3 | Boiling Point | 452.8ºC at 760 mmHg | |
| Molecular Formula | C13H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | N-ethyl-N-methyl-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760 mmHg |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.32400 |
| Flash Point | 227.7ºC |
| Exact Mass | 248.16400 |
| PSA | 48.47000 |
| LogP | 0.97690 |
| Index of Refraction | 1.549 |
| InChIKey | CMDQZBUDRBVXNM-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)c1cccnc1N1CCNCC1 |
| Storage condition | 2-8°C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD08061068 |
| N-ETHYL-N-METHYL-2-(1-PIPERAZINYL)NICOTINAMIDE |
| N-Ethyl-N-methyl-2-(piperazin-1-yl)nicotinamide |