[2-hydroxyimino-2-(4-methoxy-phenyl)-ethyl]-carbamic acid tert-butyl ester structure
|
Common Name | [2-hydroxyimino-2-(4-methoxy-phenyl)-ethyl]-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 912762-49-3 | Molecular Weight | 280.32000 | |
| Density | 1.12g/cm3 | Boiling Point | 438ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7ºC | |
| Name | [2-hydroxyimino-2-(4-methoxy-phenyl)-ethyl]-carbamic acid tert-butyl ester |
|---|
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 438ºC at 760 mmHg |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32000 |
| Flash Point | 218.7ºC |
| Exact Mass | 280.14200 |
| PSA | 80.15000 |
| LogP | 2.78910 |
| Index of Refraction | 1.515 |
| InChIKey | CMIMEDYNRDOONE-FOWTUZBSSA-N |
| SMILES | COc1ccc(C(CNC(=O)OC(C)(C)C)=NO)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |