1-(4-methylphenyl)sulfonyl-3-phenylpiperazine
Modify Date: 2025-09-04 23:22:57
1-(4-methylphenyl)sulfonyl-3-phenylpiperazine structure
|
Common Name | 1-(4-methylphenyl)sulfonyl-3-phenylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 912763-26-9 | Molecular Weight | 316.41800 | |
| Density | 1.211g/cm3 | Boiling Point | 482.1ºC at 760 mmHg | |
| Molecular Formula | C17H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.4ºC | |
| Name | 1-(4-methylphenyl)sulfonyl-3-phenylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 482.1ºC at 760 mmHg |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.41800 |
| Flash Point | 245.4ºC |
| Exact Mass | 316.12500 |
| PSA | 57.79000 |
| LogP | 3.67770 |
| Index of Refraction | 1.595 |
| InChIKey | ZDMWJJZWFHWUBA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(c3ccccc3)C2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gl-0849 |