5-(2-methoxyphenyl)-1H-pyrazin-2-one structure
|
Common Name | 5-(2-methoxyphenyl)-1H-pyrazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 912763-39-4 | Molecular Weight | 202.20900 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-methoxyphenyl)-1H-pyrazin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 54.98000 |
| LogP | 1.44550 |
| Index of Refraction | 1.598 |
| InChIKey | CNLNCZGCAPCOQO-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1c[nH]c(=O)cn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0859 |
| 5-(2-Methoxy-phenyl)-1H-pyrazin-2-one |