6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid
Modify Date: 2025-09-03 20:30:42
![6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid Structure](https://image.chemsrc.com/caspic/323/912770-34-4.png)
6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid structure
|
Common Name | 6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 912770-34-4 | Molecular Weight | 278.71400 | |
| Density | 1.6g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-Chlorophenyl)imidazo[2,1-b][1,3]thiazole-3-carboxylic acid |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Molecular Formula | C12H7ClN2O2S |
| Molecular Weight | 278.71400 |
| Exact Mass | 277.99200 |
| PSA | 82.84000 |
| LogP | 3.41440 |
| Index of Refraction | 1.755 |
| InChIKey | SIZNLUSBLMONHI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1csc2nc(-c3ccc(Cl)cc3)cn12 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |