2-(Dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(Dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 912824-84-1 | Molecular Weight | 310.218 | |
| Density | 1.18±0.1 g/cm3 | Boiling Point | 460.9±18.0 °C at 760 mmHg | |
| Molecular Formula | C18H19BO2S | Melting Point | 68.0 to 72.0 °C | |
| MSDS | N/A | Flash Point | 232.6±21.2 °C | |
| Name | 2-(Dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18±0.1 g/cm3 |
|---|---|
| Boiling Point | 460.9±18.0 °C at 760 mmHg |
| Melting Point | 68.0 to 72.0 °C |
| Molecular Formula | C18H19BO2S |
| Molecular Weight | 310.218 |
| Flash Point | 232.6±21.2 °C |
| Exact Mass | 310.119873 |
| PSA | 46.70000 |
| LogP | 4.35370 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | XPRBSZLRNLZXNT-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cccc3c2sc2ccccc23)OC1(C)C |
| HS Code | 2934999090 |
|---|
|
~%
2-(Dibenzo[b,d]... CAS#:912824-84-1 |
| Literature: Fier, Patrick S.; Luo, Jingwei; Hartwig, John F. Journal of the American Chemical Society, 2013 , vol. 135, # 7 p. 2552 - 2559 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dibenzo[b,d]thiophene, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
| 2-dibenzothiophen-4-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 2-(Dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 2-(4-Dibenzothienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |