2-(diethylamino)ethyl 4-amino-3-butoxybenzoate,3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one structure
|
Common Name | 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate,3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one | ||
|---|---|---|---|---|
| CAS Number | 91283-98-6 | Molecular Weight | 640.72200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H40N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(diethylamino)ethyl 4-amino-3-butoxybenzoate,3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C37H40N2O8 |
|---|---|
| Molecular Weight | 640.72200 |
| Exact Mass | 640.27800 |
| PSA | 140.78000 |
| LogP | 7.19330 |
| InChIKey | PAWDOGUJCZVISQ-UHFFFAOYSA-N |
| SMILES | CCCCOc1cc(C(=O)OCCN(CC)CC)ccc1N.O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccccc21 |
| Fluorescein / oxybuprocaine |
| Oxybuprocaine and fluorescein |
| Benoxinate mixture with fluorescein |
| Fluorescein mixture with oxybuprocaine |
| Fluorescein and Oxybuprocaine |